2172-02-3
| Name | HAFNIUM TERT-BUTOXIDE |
| CAS | 2172-02-3 |
| Molecular Formula | C16H36HfO4 |
| MDL Number | MFCD00070458 |
| Molecular Weight | 470.94 |
| MOL File | 2172-02-3.mol |
Chemical Properties
| Melting point | 2℃ |
| Boiling point | 90 °C5 mm Hg(lit.) |
| density | 1.166 g/mL at 25 °C(lit.) |
| refractive index | n |
| Fp | 83 °F |
| solubility | Soluble in hydrocarbons, reacts with alcohols, ketones, and esters |
| form | Liquid |
| Specific Gravity | 1.166 |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| Sensitive | Moisture Sensitive/Light Sensitive |
| Exposure limits | ACGIH: TWA 0.5 mg/m3 NIOSH: IDLH 50 mg/m3; TWA 0.5 mg/m3 |
| InChI | 1S/4C4H9O.Hf/c4*1-4(2,3)5;/h4*1-3H3;/q4*-1;+4 |
| InChIKey | WZVIPWQGBBCHJP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)O[Hf](OC(C)(C)C)(OC(C)(C)C)OC(C)(C)C |
| CAS DataBase Reference | 2172-02-3(CAS DataBase Reference) |
Safety Data
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| TSCA | No |
| HazardClass | 3 |
| PackingGroup | II |
| HS Code | 2905190019 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |