2081-12-1
| Name | ZIRCONIUM(IV) TERT-BUTOXIDE |
| CAS | 2081-12-1 |
| Molecular Formula | C16H36O4Zr |
| MDL Number | MFCD00075085 |
| Molecular Weight | 383.68 |
| MOL File | 2081-12-1.mol |
Chemical Properties
| Appearance | clear colorless to yellow fuming liquid |
| Melting point | 3°C |
| Boiling point | 81 °C/3 mmHg (lit.) |
| density | 0.985 g/mL at 25 °C(lit.) |
| refractive index | n |
| Fp | 185 °F |
| storage temp. | 2-8°C |
| form | liquid |
| color | slightly yellow |
| Specific Gravity | 0.96 |
| Water Solubility | Decomposes in water. |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| Sensitive | Moisture Sensitive |
| BRN | 3681870 |
| Exposure limits | ACGIH: TWA 5 mg/m3; STEL 10 mg/m3 NIOSH: IDLH 25 mg/m3; TWA 5 mg/m3; STEL 10 mg/m3 |
| InChI | 1S/4C4H9O.Zr/c4*1-4(2,3)5;/h4*1-3H3;/q4*-1;+4 |
| InChIKey | BGGIUGXMWNKMCP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)O[Zr](OC(C)(C)C)(OC(C)(C)C)OC(C)(C)C |
| CAS DataBase Reference | 2081-12-1(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 1993 |
| WGK Germany | 3 |
| F | 1-10 |
| TSCA | No |
| HazardClass | 3 |
| PackingGroup | III |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |