
20724-73-6
| Name | 2'-C-Methylcytidine |
| CAS | 20724-73-6 |
| EINECS(EC#) | 200-001-2 |
| Molecular Formula | C10H15N3O5 |
| MDL Number | MFCD02682947 |
| Molecular Weight | 257.24 |
| MOL File | 20724-73-6.mol |
Chemical Properties
| Appearance | White to Off-White Powder |
| Melting point | 243-245°C |
| Boiling point | 523.9±60.0 °C(Predicted) |
| density | 1.72±0.1 g/cm3(Predicted) |
| storage temp. | Hygroscopic, -20°C Freezer, Under Inert Atmosphere |
| solubility | H2O: >20mg/mL |
| form | powder |
| pka | 13.53±0.70(Predicted) |
| color | white to off-white |
| Water Solubility | H2O: >20mg/mL |
| InChI | InChI=1S/C10H15N3O5/c1-10(17)7(15)5(4-14)18-8(10)13-3-2-6(11)12-9(13)16/h2-3,5,7-8,14-15,17H,4H2,1H3,(H2,11,12,16)/t5-,7-,8-,10-/m1/s1 |
| InChIKey | PPUDLEUZKVJXSZ-VPCXQMTMSA-N |
| SMILES | OC[C@H]1O[C@@H](N2C=CC(N)=NC2=O)[C@](C)(O)[C@@H]1O |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
