206357-78-0
| Name | 3-Chloro-2-(tributylstannyl)pyridine |
| CAS | 206357-78-0 |
| Molecular Formula | C17H30ClNSn |
| MDL Number | MFCD10699157 |
| Molecular Weight | 402.59 |
| MOL File | 206357-78-0.mol |
Chemical Properties
| Boiling point | 397.2±52.0 °C(Predicted) |
| storage temp. | 2-8°C, sealed storage, away from moisture |
| pka | 2.92±0.29(Predicted) |
| Appearance | Colorless to light yellow Liquid |
| InChI | 1S/C5H3ClN.3C4H9.Sn/c6-5-2-1-3-7-4-5;3*1-3-4-2;/h1-3H;3*1,3-4H2,2H3; |
| InChIKey | UPSIWQDIUJUACS-UHFFFAOYSA-N |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1ncccc1Cl |
Safety Data
| Symbol(GHS) |    GHS06,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H301-H312-H315-H319-H360FD-H372-H410 |
| Precautionary statements | P202-P273-P280-P301+P310-P302+P352+P312-P305+P351+P338 |
| Hazard Codes | T |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2788 6.1 / PGII |
| WGK Germany | 3 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 3 Oral Acute Tox. 4 Dermal Aquatic Acute 1 Aquatic Chronic 1 Eye Irrit. 2 Repr. 1B Skin Irrit. 2 STOT RE 1 |