
1984-49-2
| Name | 3,3'-Bicarbazole |
| CAS | 1984-49-2 |
| Molecular Formula | C24H16N2 |
| MDL Number | MFCD11046470 |
| Molecular Weight | 332.4 |
| MOL File | 1984-49-2.mol |
Chemical Properties
| Melting point | 365 °C |
| Boiling point | 656.0±30.0 °C(Predicted) |
| density | 1.341 |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 16.79±0.30(Predicted) |
| color | White to Light yellow to Dark green |
| InChI | InChI=1S/C24H16N2/c1-3-7-21-17(5-1)19-13-15(9-11-23(19)25-21)16-10-12-24-20(14-16)18-6-2-4-8-22(18)26-24/h1-14,25-26H |
| InChIKey | PUMOFXXLEABBTC-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=CC=C2)C2=C1C=CC(C1=CC3C4=C(NC=3C=C1)C=CC=C4)=C2 |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | WGK 3 |
| HS Code | 2933.99.8290 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 |
