19824-59-0
| Name | PENTAKIS(DIMETHYLAMINO)TANTALUM |
| CAS | 19824-59-0 |
| Molecular Formula | C10H30N5Ta |
| MDL Number | MFCD01631286 |
| Molecular Weight | 401.33 |
| MOL File | 19824-59-0.mol |
Chemical Properties
| Melting point | 100 °C (dec.)(lit.) |
| Boiling point | 100°C 0,1mm |
| form | crystal |
| color | orange |
| Hydrolytic Sensitivity | 8: reacts rapidly with moisture, water, protic solvents |
| Sensitive | moisture sensitive |
| InChI | InChI=1S/5C2H6N.Ta/c5*1-3-2;/h5*1-2H3;/q5*-1;+5 |
| InChIKey | VSLPMIMVDUOYFW-UHFFFAOYSA-N |
| SMILES | [Ta](N(C)C)(N(C)C)(N(C)C)(N(C)C)N(C)C |
| CAS DataBase Reference | 19824-59-0 |
Safety Data
| Symbol(GHS) |   GHS02,GHS05 |
| Signal word | Danger |
| Hazard statements | H228-H260-H314 |
| Precautionary statements | P210-P231+P232-P260-P280-P303+P361+P353-P305+P351+P338 |
| Hazard Codes | F,C |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 3131 4.3/PG 1 |
| WGK Germany | 3 |
| TSCA | No |
| Storage Class | 4.3 - Hazardous materials which set free flammable gases upon contact with water |
| Hazard Classifications | Eye Dam. 1 Flam. Sol. 1 Skin Corr. 1B Water-react 1 |