
19788-37-5
| Name | 4-(CHLOROMETHYL)-3,5-DIMETHYLISOXAZOLE |
| CAS | 19788-37-5 |
| EINECS(EC#) | 243-312-4 |
| Molecular Formula | C6H8ClNO |
| MDL Number | MFCD00003154 |
| Molecular Weight | 145.59 |
| MOL File | 19788-37-5.mol |
Chemical Properties
| Appearance | Colorless to yellow liquid |
| Melting point | 88-90°C |
| Boiling point | 87-88 °C/8 mmHg (lit.) |
| density | 1.173 g/mL at 25 °C(lit.) |
| refractive index | n |
| Fp | 204 °F |
| storage temp. | 0-6°C |
| form | clear liquid |
| pka | -1.73±0.28(Predicted) |
| color | Light yellow to Brown |
| BRN | 110780 |
| InChI | InChI=1S/C6H8ClNO/c1-4-6(3-7)5(2)9-8-4/h3H2,1-2H3 |
| InChIKey | NIFAUKBQIAURIM-UHFFFAOYSA-N |
| SMILES | O1C(C)=C(CCl)C(C)=N1 |
| CAS DataBase Reference | 19788-37-5(CAS DataBase Reference) |
| EPA Substance Registry System | Isoxazole, 4-(chloromethyl)-3,5-dimethyl- (19788-37-5) |
Safety Data
| Hazard Codes | Xn,Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 3334 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| TSCA | Yes |
| HazardClass | IRRITANT |
| HS Code | 29349990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |