19780-11-1
| Name | 2-DODECEN-1-YLSUCCINIC ANHYDRIDE |
| CAS | 19780-11-1 |
| EINECS(EC#) | 246-917-1 |
| Molecular Formula | C16H26O3 |
| MDL Number | MFCD00005528 |
| Molecular Weight | 266.38 |
| MOL File | 19780-11-1.mol |
Chemical Properties
| Appearance | colourless to light yellow viscous liquid |
| Melting point | 41-43 °C(lit.) |
| Boiling point | 180-182 °C5 mm Hg(lit.) |
| density | 1.00 g/mL at 20 °C |
| vapor density | 9.2 (vs air) |
| vapor pressure | <1 mm Hg ( 20 °C) |
| refractive index | 1.5400 (estimate) |
| Fp | 352 °F |
| storage temp. | 2-8°C, protect from light |
| solubility | 5g/L in organic solvents at 20 ℃ |
| form | powder to lump |
| color | White to Orange to Green |
| Stability: | Stable, but moisture-sensitive. Combustible. Incompatible with water. |
| Water Solubility | 130μg/L at 25℃ |
| InChI | 1S/C16H26O3/c1-2-3-4-5-6-7-8-9-10-11-12-14-13-15(17)19-16(14)18/h10-11,14H,2-9,12-13H2,1H3/b11-10+ |
| InChIKey | UYCICMIUKYEYEU-ZHACJKMWSA-N |
| SMILES | CCCCCCCCC\C=C/CC1CC(=O)OC1=O |
| LogP | 4.38 at 25℃ |
| CAS DataBase Reference | 19780-11-1(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 3077 |
| WGK Germany | 3 |
| RTECS | WN1225000 |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| REACH Registrations | Active |
| HazardClass | 9 |
| PackingGroup | III |
| HS Code | 2917198025 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |