19541-95-8
| Name | 5-AMINO-3-(4-METHOXYPHENYL)PYRAZOLE |
| CAS | 19541-95-8 |
| Molecular Formula | C10H11N3O |
| MDL Number | MFCD00462192 |
| Molecular Weight | 189.21 |
| MOL File | 19541-95-8.mol |
Chemical Properties
| Melting point | 143-145°C |
| Boiling point | 466.4±40.0 °C(Predicted) |
| density | 1.240±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C, protect from light |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 14.88±0.10(Predicted) |
| color | White to Almost white |
| InChI | InChI=1S/C10H11N3O/c1-14-8-4-2-7(3-5-8)9-6-10(11)13-12-9/h2-6H,1H3,(H3,11,12,13) |
| InChIKey | UPAGEJODHNVJNM-UHFFFAOYSA-N |
| SMILES | N1C(C2=CC=C(OC)C=C2)=CC(N)=N1 |
| CAS DataBase Reference | 19541-95-8(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2933199090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |