
19393-92-1
| Name | 1-BROMO-2,6-DICHLOROBENZENE |
| CAS | 19393-92-1 |
| EINECS(EC#) | 243-018-6 |
| Molecular Formula | C6H3BrCl2 |
| MDL Number | MFCD00000574 |
| Molecular Weight | 225.9 |
| MOL File | 19393-92-1.mol |
Chemical Properties
| Appearance | white to light yellow crystal powder |
| Melting point | 61-64 °C (lit.) |
| Boiling point | 242 °C/765 mmHg (lit.) |
| density | 1.6351 (rough estimate) |
| refractive index | 1.5700 (estimate) |
| Fp | >100°C |
| storage temp. | Sealed in dry,Room Temperature |
| form | Crystalline Powder and/or Chunks |
| color | White to yellow |
| BRN | 1681054 |
| InChI | InChI=1S/C6H3BrCl2/c7-6-4(8)2-1-3-5(6)9/h1-3H |
| InChIKey | UWOIDOQAQPUVOH-UHFFFAOYSA-N |
| SMILES | C1(Cl)=CC=CC(Cl)=C1Br |
| CAS DataBase Reference | 19393-92-1(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzene, 1-bromo-2,6-dichloro-(19393-92-1) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29039990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
