
180186-94-1
| Name | (+)-2,2'-METHYLENEBIS[(3AR,8AS)-3A,8A-DIHYDRO-8H-INDENO[1,2-D]OXAZOLE] |
| CAS | 180186-94-1 |
| Molecular Formula | C21H18N2O2 |
| MDL Number | MFCD06797115 |
| Molecular Weight | 330.38 |
| MOL File | 180186-94-1.mol |
Chemical Properties
| Chemical Properties | Ethyl chloroformate is a colorless to light yellow liquid that is corrosive and flammable. It is prepared from phosgene and ethanol. It has a sharp pungent odor, like hydrochloric acid, and it decomposes in water. It is miscible with alcohol, benzene, chloroform, and ether. |
| Melting point | 225 °C |
| Boiling point | 493.2±45.0 °C(Predicted) |
| density | 1.48 |
| refractive index | 360 ° (C=1, CH2Cl2) |
| storage temp. | Inert atmosphere,2-8°C |
| form | powder to crystal |
| pka | 5.47±0.20(Predicted) |
| color | White to Almost white |
| Optical Rotation | [α]22/D +353°, c = 3.7 in chloroform |
| InChI | InChI=1S/C21H18N2O2/c1-3-7-14-12(5-1)9-16-20(14)22-18(24-16)11-19-23-21-15-8-4-2-6-13(15)10-17(21)25-19/h1-8,16-17,20-21H,9-11H2/t16-,17-,20+,21+/m0/s1 |
| InChIKey | BDHSVQLSNIGJNC-ZCLUNYJNSA-N |
| SMILES | C(C1=N[C@]2([H])C3=C(C=CC=C3)C[C@]2([H])O1)C1=N[C@]2([H])C3=C(C=CC=C3)C[C@]2([H])O1 |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| HS Code | 29349990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
