176763-62-5
| Name | (R,R)-(-)-N,N'-BIS(3,5-DI-TERT-BUTYLSALICYLIDENE)-1,2-CYCLOHEXANEDIAMINO-COBALT(II) |
| CAS | 176763-62-5 |
| Molecular Formula | C36H52CoN2O2 |
| MDL Number | MFCD01631277 |
| Molecular Weight | 603.74 |
| MOL File | 176763-62-5.mol |
Chemical Properties
| Appearance | Orange to red-brown powder |
| Melting point | >350 °C(lit.) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | Powder |
| color | Orange to red to brown |
| InChIKey | ZFWPDJKMASHRPT-DKZUAMKGNA-L |
| SMILES | C12O[Co]OC3=C(C=N[C@@H]4CCCC[C@H]4N=CC=1C=C(C(C)(C)C)C=C2C(C)(C)C)C=C(C(C)(C)C)C=C3C(C)(C)C |t:6,15,&1:8,13,r| |
Safety Data
| Symbol(GHS) |   GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H317-H372-H412 |
| Precautionary statements | P260-P264-P273-P280-P302+P352-P314 |
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| HS Code | 29349990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Aquatic Chronic 3 Skin Sens. 1A STOT RE 1 |
;