17587-22-3
| Name | 2,2-DIMETHYL-6,6,7,7,8,8,8-HEPTAFLUORO-3,5-OCTANEDIONE |
| CAS | 17587-22-3 |
| EINECS(EC#) | 241-556-6 |
| Molecular Formula | C10H11F7O2 |
| MDL Number | MFCD00000435 |
| Molecular Weight | 296.18 |
| MOL File | 17587-22-3.mol |
Chemical Properties
| Appearance | colourless liquid |
| Melting point | 38 °C |
| Boiling point | 46-47 °C/5 mmHg (lit.) |
| density | 1.273 g/mL at 25 °C(lit.) |
| refractive index | n |
| Fp | 101 °F |
| storage temp. | Flammables area |
| form | liquid |
| pka | 6.74±0.46(Predicted) |
| color | colorless to pale yellow |
| Specific Gravity | 1.273 |
| Stability: | Stable. Flammable. Incompatible with oxidizing agents, combustible material. |
| BRN | 2056991 |
| InChI | 1S/C10H11F7O2/c1-7(2,3)5(18)4-6(19)8(11,12)9(13,14)10(15,16)17/h4H2,1-3H3 |
| InChIKey | SQNZLBOJCWQLGQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)CC(=O)C(F)(F)C(F)(F)C(F)(F)F |
| CAS DataBase Reference | 17587-22-3(CAS DataBase Reference) |
| EPA Substance Registry System | 3,5-Octanedione, 6,6,7,7,8,8,8-heptafluoro-2,2-dimethyl- (17587-22-3) |
Safety Data
| Hazard Codes | Xi,F |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 1224 3/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Flammable |
| TSCA | Yes |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29147000 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Flam. Liq. 3 |