17417-09-3
| Name | 2-Fluoro-5-nitrobenzonitrile |
| CAS | 17417-09-3 |
| EINECS(EC#) | 624-527-6 |
| Molecular Formula | C7H3FN2O2 |
| MDL Number | MFCD00042299 |
| Molecular Weight | 166.11 |
| MOL File | 17417-09-3.mol |
Chemical Properties
| Appearance | white to light yellow crystal powder |
| Melting point | 76-80 °C (lit.) |
| Boiling point | 94 °C / 0.5mmHg |
| density | 1.41±0.1 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| Water Solubility | Insoluble in water |
| form | powder to crystal |
| color | White to Yellow to Green |
| BRN | 2048720 |
| InChI | InChI=1S/C7H3FN2O2/c8-7-2-1-6(10(11)12)3-5(7)4-9/h1-3H |
| InChIKey | YLACBMHBZVYOAP-UHFFFAOYSA-N |
| SMILES | C(#N)C1=CC([N+]([O-])=O)=CC=C1F |
| CAS DataBase Reference | 17417-09-3(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| Hazard Codes | Xn,Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 3439 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29269090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |