
1651-29-2
| Name | 6-Chloro-2-fluoropurine |
| CAS | 1651-29-2 |
| EINECS(EC#) | 634-083-5 |
| Molecular Formula | C5H2ClFN4 |
| MDL Number | MFCD02183557 |
| Molecular Weight | 172.55 |
| MOL File | 1651-29-2.mol |
Chemical Properties
| Melting point | 162-163°C |
| Boiling point | 221.8±50.0 °C(Predicted) |
| density | 1.98±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | DMF: 30 mg/ml,DMSO: 30 mg/ml,Ethanol: 30 mg/ml |
| form | powder to crystal |
| pka | 4.88±0.20(Predicted) |
| color | White to Light yellow to Green |
| InChI | InChI=1S/C5H2ClFN4/c6-3-2-4(9-1-8-2)11-5(7)10-3/h1H,(H,8,9,10,11) |
| InChIKey | UNRIYCIDCQDGQE-UHFFFAOYSA-N |
| SMILES | N1C2C(=NC(F)=NC=2Cl)NC=1 |
| CAS DataBase Reference | 1651-29-2(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H315-H318-H335-H319 |
| Precautionary statements | P261-P280-P305+P351+P338-P280a-P304+P340-P405-P501a |
| Hazard Codes | Xi,Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| HS Code | 29335990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |

