
1631-25-0
| Name | N-Cyclohexylmaleimide |
| CAS | 1631-25-0 |
| EINECS(EC#) | 216-630-6 |
| Molecular Formula | C10H13NO2 |
| MDL Number | MFCD00043904 |
| Molecular Weight | 179.22 |
| MOL File | 1631-25-0.mol |
Chemical Properties
| Melting point | 89-91 °C (lit.) |
| Boiling point | 132 °C / 17mmHg |
| density | 1.226±0.06 g/cm3(Predicted) |
| vapor pressure | 80Pa at 25℃ |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Insoluble in water |
| form | powder to lump |
| pka | -2.26±0.20(Predicted) |
| color | White to Almost white |
| Water Solubility | 260mg/L at 25℃ |
| InChI | InChI=1S/C10H13NO2/c12-9-6-7-10(13)11(9)8-4-2-1-3-5-8/h6-8H,1-5H2 |
| InChIKey | BQTPKSBXMONSJI-UHFFFAOYSA-N |
| SMILES | N1(C2CCCCC2)C(=O)C=CC1=O |
| LogP | 2.57 at 23℃ |
| CAS DataBase Reference | 1631-25-0(CAS DataBase Reference) |
| EPA Substance Registry System | 1631-25-0(EPA Substance) |
Safety Data
| Symbol(GHS) | ![]() ![]() GHS06,GHS09 |
| Signal word | Danger |
| Hazard statements | H301-H315-H317-H319-H335-H410 |
| Precautionary statements | P261-P273-P280-P301+P310-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 2811 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| TSCA | Yes |
| REACH Registrations | Active |
| HazardClass | 6.1 |
| PackingGroup | II |
| HS Code | 29251900 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Aquatic Acute 1 Aquatic Chronic 3 Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1A STOT SE 3 |

