16292-17-4
| Name | BIS(4-BROMOPHENYL)AMINE |
| CAS | 16292-17-4 |
| EINECS(EC#) | 628-026-3 |
| Molecular Formula | C12H9Br2N |
| MDL Number | MFCD00225488 |
| Molecular Weight | 327.01 |
| MOL File | 16292-17-4.mol |
Chemical Properties
| Melting point | 106 °C |
| Boiling point | 380.5±27.0 °C(Predicted) |
| density | 1.740±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | -0.55±0.40(Predicted) |
| color | White to Almost white |
| InChI | InChI=1S/C12H9Br2N/c13-9-1-5-11(6-2-9)15-12-7-3-10(14)4-8-12/h1-8,15H |
| InChIKey | VKVHTZNHLOGHGP-UHFFFAOYSA-N |
| SMILES | C1(NC2=CC=C(Br)C=C2)=CC=C(Br)C=C1 |
Safety Data
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H318-H413 |
| Precautionary statements | P264-P270-P273-P280-P301+P312-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| HS Code | 29214400 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 4 Eye Dam. 1 |
