
16234-14-3
| Name | 2,4-Dichlorothieno[3,2-d]pyrimidine |
| CAS | 16234-14-3 |
| EINECS(EC#) | 695-110-4 |
| Molecular Formula | C6H2Cl2N2S |
| MDL Number | MFCD08448158 |
| Molecular Weight | 205.064 |
| MOL File | 16234-14-3.mol |
Chemical Properties
| Melting point | 136.0 to 140.0 °C |
| Boiling point | 274.8±22.0 °C(Predicted) |
| density | 1.662±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | -0.72±0.40(Predicted) |
| color | White to Almost white |
| InChI | InChI=1S/C6H2Cl2N2S/c7-5-4-3(1-2-11-4)9-6(8)10-5/h1-2H |
| InChIKey | AQECFYPZMBRCIA-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC(Cl)=C2SC=CC2=N1 |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H332-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| Safety Statements | |
| RIDADR | UN2811 |
| WGK Germany | WGK 3 |
| HazardClass | IRRITANT |
| HS Code | 29335990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 |
