Methyl 3-amino-2-thiophenecarboxylate
- Product NameMethyl 3-amino-2-thiophenecarboxylate
- CAS22288-78-4
- MFC6H7NO2S
- MW157.19
- EINECS244-895-8
- MOL File22288-78-4.mol
Chemical Properties
| Melting point | 62-64 °C (lit.) |
| Boiling point | 100-102 °C/0.1 mmHg (lit.) |
| Density | 1.274 (estimate) |
| refractive index | 1.5500 (estimate) |
| Flash point | 100-102°C/0.1mm |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Soluble in alcohol, toluene, xylene and other solvents |
| form | Fine Crystalline Powder |
| pka | 1.86±0.10(Predicted) |
| color | Beige to beige-brown |
| Water Solubility | Slightly soluble in water. |
| BRN | 1365614 |
| InChI | InChI=1S/C6H7NO2S/c1-9-6(8)5-4(7)2-3-10-5/h2-3H,7H2,1H3 |
| InChIKey | TWEQNZZOOFKOER-UHFFFAOYSA-N |
| SMILES | C1(C(OC)=O)SC=CC=1N |
| CAS DataBase Reference | 22288-78-4(CAS DataBase Reference) |
| EPA Substance Registry System | 2-Thiophenecarboxylic acid, 3-amino-, methyl ester (22288-78-4) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39-36/37/39-22 |
| WGK Germany | 3 |
| RTECS | XM8347500 |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| HS Code | 29349990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
