
1614-12-6
| Name | 1-Aminobenzotriazole |
| CAS | 1614-12-6 |
| Molecular Formula | C6H6N4 |
| MDL Number | MFCD00132902 |
| Molecular Weight | 134.14 |
| MOL File | 1614-12-6.mol |
Chemical Properties
| Appearance | yellow to beige or light brown crystalline powder |
| Melting point | 81-84 °C (lit.) |
| Boiling point | 237.24°C (rough estimate) |
| density | 1.2769 (rough estimate) |
| refractive index | 1.7000 (estimate) |
| RTECS | DM1235000 |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Soluble in DMSO (up to 30mg/ml) |
| form | Crystalline Powder |
| pka | 2.09±0.30(Predicted) |
| color | Yellow to beige or light brown |
| Water Solubility | slightly soluble |
| BRN | 607843 |
| Stability: | Stable for 1 year from date of purchase as supplied. Solutions in DMSO may be stored at -20°C for up to 1 month. |
| InChI | InChI=1S/C6H6N4/c7-10-6-4-2-1-3-5(6)8-9-10/h1-4H,7H2 |
| InChIKey | JCXKHYLLVKZPKE-UHFFFAOYSA-N |
| SMILES | N1(N)C2=CC=CC=C2N=N1 |
| CAS DataBase Reference | 1614-12-6(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29349990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
