1539-42-0
| Name | 2,2'-DIPICOLYLAMINE |
| CAS | 1539-42-0 |
| EINECS(EC#) | 216-266-8 |
| Molecular Formula | C12H13N3 |
| MDL Number | MFCD00129044 |
| Molecular Weight | 199.25 |
| MOL File | 1539-42-0.mol |
Chemical Properties
| Boiling point | 139-141 °C1 mm Hg(lit.) |
| density | 1.107 g/mL at 25 °C(lit.) |
| refractive index | n |
| Fp | >230 °F |
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C |
| solubility | water: soluble (partially miscible)(lit.) |
| form | clear liquid |
| pka | 5.89±0.20(Predicted) |
| color | White to Yellow to Green |
| Water Solubility | water: soluble (partially miscible)(lit.) |
| InChI | InChI=1S/C12H13N3/c1-3-7-14-11(5-1)9-13-10-12-6-2-4-8-15-12/h1-8,13H,9-10H2 |
| InChIKey | KXZQYLBVMZGIKC-UHFFFAOYSA-N |
| SMILES | C1(CNCC2=NC=CC=C2)=NC=CC=C1 |
| EPA Substance Registry System | 2,2'-Dipicolylamine (1539-42-0) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29333990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |