
1532-97-4
| Name | 4-Bromoisoquinoline |
| CAS | 1532-97-4 |
| EINECS(EC#) | 216-244-8 |
| Molecular Formula | C9H6BrN |
| MDL Number | MFCD00006904 |
| Molecular Weight | 208.05 |
| MOL File | 1532-97-4.mol |
Chemical Properties
| Appearance | Pale Yellow Solid |
| Melting point | 40-43 °C (lit.) |
| Boiling point | 280-285 °C (lit.) |
| density | 1.5617 (rough estimate) |
| refractive index | 1.6641 (estimate) |
| Fp | >230 °F |
| storage temp. | Refrigerator (+4°C) |
| solubility | Chloroform, Methanol |
| form | Crystalline Solid |
| pka | 3.30±0.10(Predicted) |
| color | White to light beige |
| Usage | Shows selective inhibition of cAMP-dependent protein kinase |
| Detection Methods | HPLC,NMR,GC |
| BRN | 114431 |
| InChI | InChI=1S/C9H6BrN/c10-9-6-11-5-7-3-1-2-4-8(7)9/h1-6H |
| InChIKey | SCRBSGZBTHKAHU-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC=C2)C(Br)=CN=1 |
| CAS DataBase Reference | 1532-97-4(CAS DataBase Reference) |
| NIST Chemistry Reference | Isoquinoline, 4-bromo-(1532-97-4) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| HS Code | 29334900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
