
152-72-7
| Name | ACENOCOUMAROL |
| CAS | 152-72-7 |
| EINECS(EC#) | 205-807-3 |
| Molecular Formula | C19H15NO6 |
| MDL Number | MFCD00137816 |
| Molecular Weight | 353.33 |
| MOL File | 152-72-7.mol |
Chemical Properties
| Appearance | White Crystalline Solid |
| Melting point | 196-1990C |
| Boiling point | 486.76°C (rough estimate) |
| density | 1.3979 (rough estimate) |
| refractive index | 1.5000 (estimate) |
| storage temp. | -20°C Freezer |
| solubility | DMSO, heptane and xylene: ≥17mg/mL |
| form | powder |
| pka | pKa 4.7 (Uncertain) |
| color | white to tan |
| InChI | 1S/C19H15NO6/c1-11(21)10-15(12-6-8-13(9-7-12)20(24)25)17-18(22)14-4-2-3-5-16(14)26-19(17)23/h2-9,15,22H,10H2,1H3 |
| InChIKey | VABCILAOYCMVPS-UHFFFAOYSA-N |
| SMILES | CC(=O)CC(c1ccc(cc1)[N+]([O-])=O)C2=C(O)c3ccccc3OC2=O |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 2811 |
| WGK Germany | 3 |
| RTECS | GN4900000 |
| HS Code | 2932.20.2000 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Hazardous Substances Data | 152-72-7(Hazardous Substances Data) |
| Toxicity |
