
1513-87-7
| Name | TFEC |
| CAS | 1513-87-7 |
| Molecular Formula | C5H4F6O3 |
| MDL Number | MFCD11857845 |
| Molecular Weight | 226.074 |
| MOL File | 1513-87-7.mol |
Chemical Properties
| Boiling point | 118°C(lit.) |
| density | 1.470±0.06 g/cm3(Predicted) |
| refractive index | 1.3120 to 1.3160 |
| storage temp. | Store at room temperature, keep dry and cool |
| solubility | Chloroform (Soluble), Methanol (Slightly) |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Major Application | battery manufacturing |
| InChI | InChI=1S/C5H4F6O3/c6-4(7,8)1-13-3(12)14-2-5(9,10)11/h1-2H2 |
| InChIKey | WLLOZRDOFANZMZ-UHFFFAOYSA-N |
| SMILES | C(OCC(F)(F)F)(=O)OCC(F)(F)F |
Safety Data
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H226-H315-H319-H335 |
| Precautionary statements | P210-P241-P261 |
| RIDADR | UN 3272 3/PG II |
| WGK Germany | WGK 3 |
| HazardClass | 3 |
| PackingGroup | II |
| HS Code | 2920901090 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 |

