14919-77-8
| Name | Benserazide hydrochloride |
| CAS | 14919-77-8 |
| EINECS(EC#) | 238-991-9 |
| Molecular Formula | C10H16ClN3O5 |
| MDL Number | MFCD00078571 |
| Molecular Weight | 293.7 |
| MOL File | 14919-77-8.mol |
Chemical Properties
| Appearance | White Crystalline Solid |
| Melting point | 146°C |
| storage temp. | 2-8°C |
| solubility | H2O: 10 mg/mL |
| form | solid |
| color | White to Off-White |
| PH | pH(10g/L, 25℃) : 4.0～5.0 |
| biological source | synthetic |
| Water Solubility | Soluble in water, dimethyl sulfoxide and methanol. Insoluble in ethanol and acetone. |
| Sensitive | Light Sensitive |
| Usage | Used as antiparkinsonian. A peripheral decarboxylase inhibitor |
| λmax | 272nm(HCl aq.)(lit.) |
| Merck | 14,1050 |
| InChI | InChI=1S/C10H15N3O5.ClH/c11-6(4-14)10(18)13-12-3-5-1-2-7(15)9(17)8(5)16;/h1-2,6,12,14-17H,3-4,11H2,(H,13,18);1H |
| InChIKey | ULFCBIUXQQYDEI-UHFFFAOYSA-N |
| SMILES | C(NNCC1=CC=C(O)C(O)=C1O)(=O)C(CO)N.[H]Cl |
| CAS DataBase Reference | 14919-77-8(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 2 |
| RTECS | VT9632300 |
| HS Code | 29280000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |