1458-18-0
| Name | METHYL 3-AMINO-5,6-DICHLORO-2-PYRAZINECARBOXYLATE |
| CAS | 1458-18-0 |
| EINECS(EC#) | 215-947-7 |
| Molecular Formula | C6H5Cl2N3O2 |
| MDL Number | MFCD00010431 |
| Molecular Weight | 222.03 |
| MOL File | 1458-18-0.mol |
Chemical Properties
| Appearance | light brown to red-brown powder |
| Melting point | 227-230 °C |
| Boiling point | 357.3±37.0 °C(Predicted) |
| density | 1.586 |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Dichloromethane (Slightly), DMSO (Slightly) |
| form | Powder |
| pka | -2.74±0.10(Predicted) |
| color | Light brown to red-brown |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChI | InChI=1S/C6H5Cl2N3O2/c1-13-6(12)2-5(9)11-4(8)3(7)10-2/h1H3,(H2,9,11) |
| InChIKey | USYMCUGEGUFUBI-UHFFFAOYSA-N |
| SMILES | C1(C(OC)=O)=NC(Cl)=C(Cl)N=C1N |
| LogP | 1.9-2.2 at 35℃ |
| CAS DataBase Reference | 1458-18-0(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H332-H335 |
| Precautionary statements | P261-P264-P271-P302+P352-P304+P340+P312-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Hazard Note | Harmful |
| REACH Registrations | Active |
| HS Code | 29339980 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Inhalation Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |