1450-75-5
| Name | 5-Bromo-2-hydroxyacetophenone |
| CAS | 1450-75-5 |
| EINECS(EC#) | 604-457-2 |
| Molecular Formula | C8H7BrO2 |
| MDL Number | MFCD00191850 |
| Molecular Weight | 215.04 |
| MOL File | 1450-75-5.mol |
Chemical Properties
| Appearance | White to pale yellow crystalline powder |
| Melting point | 58-61 °C(lit.) |
| Boiling point | 135-143 °C(Press: 16 Torr) |
| density | 1.586±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Soluble in Chloroform |
| form | Solid |
| pka | 9.59±0.18(Predicted) |
| color | White to pale yellow |
| InChI | InChI=1S/C8H7BrO2/c1-5(10)7-4-6(9)2-3-8(7)11/h2-4,11H,1H3 |
| InChIKey | HQCCNFFIOWYINW-UHFFFAOYSA-N |
| SMILES | C(=O)(C1=CC(Br)=CC=C1O)C |
| LogP | 3.110 (est) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| RTECS | KM5556350 |
| Hazard Note | Irritant |
| HazardClass | IRRITANT |
| HS Code | 29147000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Toxicity |