
144189-73-1
| Name | DOTAP |
| CAS | 144189-73-1 |
| Molecular Formula | C43H83NO7S |
| MDL Number | MFCD16660441 |
| Molecular Weight | 758.19 |
| MOL File | 144189-73-1.mol |
Chemical Properties
| density | 1.11 g/cm3 |
| storage temp. | 2-8°C |
| solubility | Acetonitrile: Slightly soluble Water: Slightly soluble |
| form | buffered aqueous suspension |
| color | clear to hazy colorless to faint yellow |
| InChIKey | RSMRWWHFJMENJH-LQDDAWAPSA-M |
| SMILES | C(C[N+](C)(C)C)(COC(=O)CCCCCCC/C=C\CCCCCCCC)OC(=O)CCCCCCC/C=C\CCCCCCCC.S([O-])(=O)(=O)OC |
Safety Data
| Symbol(GHS) | ![]() ![]() GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H302-H315-H319-H331-H336-H351-H361d-H372 |
| Precautionary statements | P202-P301+P312-P302+P352-P304+P340+P311-P305+P351+P338-P308+P313 |
| WGK Germany | 3 |
| Storage Class | 6.1D - Non-combustible acute toxic Cat.3 toxic hazardous materials or hazardous materials causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Inhalation Acute Tox. 4 Oral Carc. 2 Eye Irrit. 2 Repr. 2 Skin Irrit. 2 STOT RE 1 Oral STOT SE 3 |

