Chemical Properties
| Boiling point | 299.0±35.0 °C(Predicted) |
| density | 1.629±0.06 g/cm3(Predicted) |
| form | solid |
| pka | 3.70±0.49(Predicted) |
| Appearance | White to off-white Solid |
| InChI | 1S/C10H6BrF2NO/c11-6-1-2-8-7(5-6)9(3-4-14-8)15-10(12)13/h1-5,10H |
| InChIKey | VNCDLPRFVBATOQ-UHFFFAOYSA-N |
| SMILES | BrC1=CC2=C(N=CC=C2OC(F)F)C=C1 |
Safety Data
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H300-H319 |
| Precautionary statements | P264-P301+P310-P305+P351+P338 |
| WGK Germany | WGK 3 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 2 Oral Eye Irrit. 2 |