142246-48-8
| Name | 4-CHLORO-7-CHLOROSULFONYL-2,1,3-BENZOXADIAZOLE |
| CAS | 142246-48-8 |
| Molecular Formula | C6H2Cl2N2O3S |
| MDL Number | MFCD00191405 |
| Molecular Weight | 253.06 |
| MOL File | 142246-48-8.mol |
Chemical Properties
| Melting point | 85.0 to 89.0 °C |
| Boiling point | 361.7±45.0 °C(Predicted) |
| density | 1.789±0.06 g/cm3(Predicted) |
| storage temp. | room temp |
| form | powder to crystal |
| pka | -6.24±0.50(Predicted) |
| color | White to Light yellow to Light orange |
| λmax | 324 nm |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChI | 1S/C6H2Cl2N2O3S/c7-3-1-2-4(14(8,11)12)6-5(3)9-13-10-6/h1-2H |
| InChIKey | BPPRLMZEVZSIIJ-UHFFFAOYSA-N |
| SMILES | Clc1ccc(c2nonc12)S(Cl)(=O)=O |
| CAS DataBase Reference | 142246-48-8 |
Safety Data
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 |
| Hazard Codes | Xi,C |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 3261 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | IRRITANT |
| PackingGroup | III |
| HS Code | 2934999090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |