
14205-46-0
| Name | Isopropyl 3-aminocrotonate |
| CAS | 14205-46-0 |
| EINECS(EC#) | 604-269-0 |
| Molecular Formula | C7H13NO2 |
| MDL Number | MFCD00134272 |
| Molecular Weight | 143.18 |
| MOL File | 14205-46-0.mol |
Chemical Properties
| Appearance | Colourless Liquid |
| Melting point | 19-23°C |
| Boiling point | 80°C/1mmHg(lit.) |
| density | 0.987±0.06 g/cm3(Predicted) |
| refractive index | 1.4870 to 1.4910 |
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C |
| solubility | Chloroform, Ethyl Acetate, Methanol |
| form | Colourless Liquid |
| pka | 5.36±0.70(Predicted) |
| color | Colorless to Light yellow |
| InChI | InChI=1S/C7H13NO2/c1-5(2)10-7(9)4-6(3)8/h4-5H,8H2,1-3H3 |
| InChIKey | YCKAGGHNUHZKCL-UHFFFAOYSA-N |
| SMILES | C(OC(C)C)(=O)C=C(N)C |
| CAS DataBase Reference | 14205-46-0(CAS DataBase Reference) |