1403-36-7
| Name | CHAETOMIN |
| CAS | 1403-36-7 |
| Molecular Formula | C31H30N6O6S4 |
| MDL Number | MFCD28137713 |
| Molecular Weight | 710.87 |
| MOL File | 1403-36-7.mol |
Chemical Properties
| Melting point | 218-220℃ (chloroform ) |
| density | 1.78±0.1 g/cm3(Predicted) |
| storage temp. | -20°C |
| solubility | DMSO: soluble |
| form | Off-white to fawn solid. |
| pka | 12.69±0.10(Predicted) |
| color | Off-white to fawn |
| biological source | mouse |
| InChIKey | ZRZWBWPDBOVIGQ-UHFFFAOYSA-N |
| SMILES | S1SC9(N(C(=O)C1(N(C9=O)C)CO)C)Cc2c3c([n](c2)C54C(N7C8(SSC(N(C8=O)C)(C7=O)CO)C5)Nc6c4cccc6)cccc3 |
Safety Data
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H301 |
| Precautionary statements | P301+P310 |
| Hazard Codes | T |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2811 6.1 / PGIII |
| WGK Germany | 3 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral |
| Toxicity |