
13754-86-4
| Name | 1,5,6,7-TETRAHYDRO-4H-INDOL-4-ONE |
| CAS | 13754-86-4 |
| Molecular Formula | C8H9NO |
| MDL Number | MFCD00075438 |
| Molecular Weight | 135.16 |
| MOL File | 13754-86-4.mol |
Chemical Properties
| Melting point | 188-190 °C (lit.) |
| Boiling point | 311℃ |
| density | 1.216 |
| Fp | 150℃ |
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C |
| form | powder to crystal |
| pka | 15.91±0.20(Predicted) |
| color | White to Light yellow to Light orange |
| InChI | InChI=1S/C8H9NO/c10-8-3-1-2-7-6(8)4-5-9-7/h4-5,9H,1-3H2 |
| InChIKey | KASJZXHXXNEULX-UHFFFAOYSA-N |
| SMILES | N1C2=C(C(=O)CCC2)C=C1 |
| CAS DataBase Reference | 13754-86-4(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| HS Code | 2914390090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
