
1352642-37-5
| Name | 2,6-Bis(triMethyltin)-4,8-bis(5-(2-ethylhexyl)thiophen-2-yl)benzo [1,2-b:4,5-b']dithiophene |
| CAS | 1352642-37-5 |
| EINECS(EC#) | 807-960-7 |
| Molecular Formula | C40H58S4Sn2 |
| MDL Number | MFCD30607286 |
| Molecular Weight | 904.57 |
| MOL File | 1352642-37-5.mol |
Chemical Properties
| Boiling point | 767.8±70.0 °C(Predicted) |
| storage temp. | 2-8°C |
| form | powder |
| color | Light orange to Yellow to Green |
| InChIKey | OCFFMJYHZKHRKM-UHFFFAOYSA-N |
| SMILES | C12=C(C3SC(CC(CC)CCCC)=CC=3)C3C=C([Sn](C)(C)C)SC=3C(C3SC(CC(CC)CCCC)=CC=3)=C1C=C([Sn](C)(C)C)S2 |
| Description | |
| Odor | Light yellow crystals |
Safety Data
| Symbol(GHS) | ![]() ![]() GHS06,GHS09 |
| Signal word | Danger |
| Hazard statements | H300+H310+H330-H410 |
| Precautionary statements | P260-P262-P273-P280-P302+P352+P310-P304+P340+P310 |
| RIDADR | UN 3146 6.1/PG I |
| WGK Germany | WGK 3 |
| HS Code | 2934.99.4400 |
| HazardClass | 6.1 |
| PackingGroup | I |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 1 Dermal Acute Tox. 2 Inhalation Acute Tox. 2 Oral Aquatic Acute 1 Aquatic Chronic 1 |

