124898-13-1
| Name | (PENTAFLUOROETHYL)TRIMETHYLSILANE |
| CAS | 124898-13-1 |
| Molecular Formula | C5H9F5Si |
| MDL Number | MFCD04116436 |
| Molecular Weight | 192.2 |
| MOL File | 124898-13-1.mol |
Chemical Properties
| Boiling point | 60 °C |
| density | 1.095 g/mL |
| refractive index | 1.3270 |
| Fp | -17℃ |
| storage temp. | Storage temp. 2-8°C |
| solubility | Miscible with tetrahydrofuran. |
| form | liquid |
| color | colorless |
| Specific Gravity | 1.05 |
| Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions |
| Sensitive | Moisture Sensitive |
| Stability: | Moisture Sensitive, Volatile |
| InChI | InChI=1S/C5H9F5Si/c1-11(2,3)5(9,10)4(6,7)8/h1-3H3 |
| InChIKey | MTPVUVINMAGMJL-UHFFFAOYSA-N |
| SMILES | [Si](C)(C)(C)C(F)(F)C(F)(F)F |
| CAS DataBase Reference | 124898-13-1(CAS DataBase Reference) |
| EPA Substance Registry System | (Pentafluoroethyl)trimethylsilane (124898-13-1) |
Safety Data
| Symbol(GHS) |   GHS02,GHS07 |
| Signal word | Danger |
| Hazard statements | H225-H315-H319-H335 |
| Precautionary statements | P210-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 1993 |
| WGK Germany | WGK 3 |
| Hazard Note | Irritant |
| TSCA | No |
| HazardClass | 3 |
| PackingGroup | II |
| HS Code | 2931900090 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 2 Skin Irrit. 2 STOT SE 3 |