1228182-44-2
| Name | Cimaterol-d7 |
| CAS | 1228182-44-2 |
| Molecular Formula | C12H17N3O |
| MDL Number | MFCD16652571 |
| Molecular Weight | 219.283 |
| MOL File | 1228182-44-2.mol |
Chemical Properties
| Melting point | 164-166°C |
| storage temp. | -20°C Freezer, Under Inert Atmosphere |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | neat |
| color | Off-White to Pale Yellow |
| Major Application | forensics and toxicology veterinary |
| InChI | InChI=1S/C12H17N3O/c1-8(2)15-7-12(16)9-3-4-11(14)10(5-9)6-13/h3-5,8,12,15-16H,7,14H2,1-2H3/i1D3,2D3,8D |
| InChIKey | BUXRLJCGHZZYNE-UNAVHCQLSA-N |
| SMILES | C(C1C=CC(=C(C=1)C#N)N)(O)CNC([2H])(C([2H])([2H])[2H])C([2H])([2H])[2H] |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H317-H319 |
| Precautionary statements | P261-P264-P280-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Sens. 1 |