1217220-85-3
| Name | Nitrofurazone-<sup>13</sup>C,<sup>15</sup>N<sub>2</sub> |
| CAS | 1217220-85-3 |
| Molecular Formula | C6H6N4O4 |
| MDL Number | MFCD16652529 |
| Molecular Weight | 201.163 |
| MOL File | 1217220-85-3.mol |
Chemical Properties
| form | neat |
| color | White to yellow |
| Major Application | forensics and toxicology pharmaceutical (small molecule) veterinary |
| InChI | InChI=1S/C6H6N4O4/c7-6(11)9-8-3-4-1-2-5(14-4)10(12)13/h1-3H,(H3,7,9,11)/b8-3+/i6+1,8+1,9+1 |
| InChIKey | IAIWVQXQOWNYOU-LTGGZAIESA-N |
| SMILES | O1C(=C([H])C([H])=C1/C(/[H])=[15N]/[15N]([H])[13C](N([H])[H])=O)[N+](=O)[O-] |
Safety Data
| Symbol(GHS) |   GHS07,GHS08 |
| Signal word | Warning |
| Hazard statements | H302-H317-H341-H351-H361fd-H373-H412 |
| Precautionary statements | P201-P273-P280-P301+P312-P302+P352-P308+P313 |
| Hazard Codes | Xn |
| Risk Statements | |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 3 Carc. 2 Muta. 2 Repr. 2 Skin Sens. 1 STOT RE 2 |