1204-60-0
| Name | 3-Phenylbenzaldehyde |
| CAS | 1204-60-0 |
| Molecular Formula | C13H10O |
| MDL Number | MFCD01740432 |
| Molecular Weight | 182.22 |
| MOL File | 1204-60-0.mol |
Chemical Properties
| Melting point | 167-168 °C |
| Boiling point | 125°C/1mmHg(lit.) |
| density | 1.118 g/mL at 25 °C |
| refractive index | 1.6290-1.6330 |
| Fp | >110℃ |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | clear liquid |
| color | Colorless to Light yellow to Light orange |
| Sensitive | Air Sensitive |
| InChI | InChI=1S/C13H10O/c14-10-11-5-4-8-13(9-11)12-6-2-1-3-7-12/h1-10H |
| InChIKey | KFKSIUOALVIACE-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=CC=C2)=CC=CC(C=O)=C1 |
| CAS DataBase Reference | 1204-60-0(CAS DataBase Reference) |
Safety Data
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| RTECS | DV1771500 |
| Hazard Note | Irritant |
| HS Code | 2912290090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |