1202864-83-2
| Name | 2,4-DICHLOROPHENOL 13C6 |
| CAS | 1202864-83-2 |
| Molecular Formula | C6H4Cl2O |
| MDL Number | MFCD01076500 |
| Molecular Weight | 169.06 |
| MOL File | 1202864-83-2.mol |
Chemical Properties
| Melting point | approximate 44℃ |
| solubility | Chloroform (Slightly), Dichloromethane (Slightly), Methanol (Slightly) |
| form | Low-Melting Solid |
| color | White to Off-White |
| InChI | 1S/C6H4Cl2O/c7-4-1-2-6(9)5(8)3-4/h1-3,9H/i1+1,2+1,3+1,4+1,5+1,6+1 |
| InChIKey | HFZWRUODUSTPEG-IDEBNGHGSA-N |
| SMILES | O[13c]1[13cH][13cH][13c](Cl)[13cH][13c]1Cl |
Safety Data
| Symbol(GHS) |    GHS09,GHS05,GHS06 |
| Signal word | Danger |
| Hazard statements | H411-H302-H311-H314 |
| Precautionary statements | P264-P270-P301+P312-P330-P501-P280-P302+P352-P312-P322-P361-P363-P405-P501-P260-P264-P280-P301+P330+P331-P303+P361+P353-P363-P304+P340-P310-P321-P305+P351+P338-P405-P501 |
| Hazard Codes | T,N |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | WGK 3 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 4 Oral Aquatic Chronic 2 Eye Dam. 1 Skin Corr. 1B |