
118129-60-5
| Name | HONGHUI-MED 480010000000 |
| CAS | 118129-60-5 |
| Molecular Formula | C24H6Br2O6 |
| MDL Number | MFCD11870875 |
| Molecular Weight | 550.113 |
| MOL File | 118129-60-5.mol |
Chemical Properties
| Melting point | 360°C(lit.) |
| Boiling point | 840.2±65.0 °C(Predicted) |
| density | 2.159±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C |
| form | powder |
| color | Orange to Brown to Dark red |
| λmax | 524nm(DMSO)(lit.) |
| InChI | InChI=1S/C24H6Br2O6/c25-13-5-12-16-10(22(28)32-24(12)30)4-2-8-18-14(26)6-11-15-9(21(27)31-23(11)29)3-1-7(19(15)18)17(13)20(8)16/h1-6H |
| InChIKey | WPBVUAVIGWNDGT-UHFFFAOYSA-N |
| SMILES | C1(=O)OC(=O)C2=CC(Br)=C3C4=C2C1=CC=C4C1=C2C4=C(C=C1Br)C(=O)OC(=O)C4=CC=C32 |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| WGK Germany | WGK 3 |
| HS Code | 2932990090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
