118-82-1
| Name | 4,4'-Methylenebis(2,6-di-tert-butylphenol) |
| CAS | 118-82-1 |
| EINECS(EC#) | 204-279-1 |
| Molecular Formula | C29H44O2 |
| MDL Number | MFCD00008822 |
| Molecular Weight | 424.66 |
| MOL File | 118-82-1.mol |
Chemical Properties
| Melting point | 155-159 °C(lit.) |
| Boiling point | 289 °C40 mm Hg(lit.) |
| density | 0.99 g/cm3 (20℃) |
| vapor pressure | 0Pa at 25℃ |
| refractive index | 1.4875 (estimate) |
| Fp | 289°C/40mm |
| storage temp. | Store below +30°C. |
| solubility | <0.0001g/l |
| form | solid |
| pka | 12.03±0.40(Predicted) |
| color | White |
| Water Solubility | 31.9ng/L at 20℃ |
| BRN | 1916919 |
| Stability: | Stable for 2 years from date of purchase as supplied. Solutions are not stable. Solutions must be made fresh and used within 1 working day. |
| InChI | 1S/C29H44O2/c1-26(2,3)20-14-18(15-21(24(20)30)27(4,5)6)13-19-16-22(28(7,8)9)25(31)23(17-19)29(10,11)12/h14-17,30-31H,13H2,1-12H3 |
| InChIKey | MDWVSAYEQPLWMX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1cc(Cc2cc(c(O)c(c2)C(C)(C)C)C(C)(C)C)cc(c1O)C(C)(C)C |
| LogP | 8.9 at 25℃ |
| CAS DataBase Reference | 118-82-1(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 1 |
| RTECS | SL9650000 |
| TSCA | Yes |
| REACH Registrations | Active |
| HS Code | 29072990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Toxicity |