116751-24-7
| Name | 3-Hydroxy-2,4,5-trifluorobenzoic acid |
| CAS | 116751-24-7 |
| Molecular Formula | C7H3F3O3 |
| MDL Number | MFCD00800378 |
| Molecular Weight | 192.09 |
| MOL File | 116751-24-7.mol |
Chemical Properties
| Appearance | white to light yellow crystal powder |
| Melting point | 143-147 °C(lit.) |
| Boiling point | 292.6±40.0 °C(Predicted) |
| density | 1.699±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C, stored under nitrogen |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 2.75±0.10(Predicted) |
| color | White to Almost white |
| Detection Methods | HPLC,NMR |
| InChI | InChI=1S/C7H3F3O3/c8-3-1-2(7(12)13)4(9)6(11)5(3)10/h1,11H,(H,12,13) |
| InChIKey | YYAFUGSJSHXYNK-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC(F)=C(F)C(O)=C1F |
| CAS DataBase Reference | 116751-24-7(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | IRRITANT |
| HS Code | 29182900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
