
116632-39-4
| Name | 5-BROMO-2-IODOTOLUENE |
| CAS | 116632-39-4 |
| EINECS(EC#) | 629-570-4 |
| Molecular Formula | C7H6BrI |
| MDL Number | MFCD00060664 |
| Molecular Weight | 296.93 |
| MOL File | 116632-39-4.mol |
Chemical Properties
| Appearance | clear slightly yellow to light red-pink liquid |
| Boiling point | 263 °C (lit.) |
| density | 2.08 g/mL at 25 °C(lit.) |
| refractive index | n |
| Fp | >230 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | clear liquid |
| color | Light orange to Yellow to Green |
| Specific Gravity | 2.08 |
| Sensitive | Light Sensitive |
| BRN | 2325157 |
| InChI | InChI=1S/C7H6BrI/c1-5-4-6(8)2-3-7(5)9/h2-4H,1H3 |
| InChIKey | GHTUADBHTFHMNI-UHFFFAOYSA-N |
| SMILES | C1(I)=CC=C(Br)C=C1C |
| CAS DataBase Reference | 116632-39-4(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280a-P304+P340-P405-P501a-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 2810 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29039990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
