1159824-67-5
| Name | CZC24832 |
| CAS | 1159824-67-5 |
| EINECS(EC#) | 200-258-5 |
| Molecular Formula | C15H17FN6O2S |
| MDL Number | MFCD22417090 |
| Molecular Weight | 364.4 |
| MOL File | 1159824-67-5.mol |
Chemical Properties
| density | 1.51 |
| storage temp. | Store at -20°C |
| solubility | insoluble in H2O; insoluble in EtOH; ≥6.07 mg/mL in DMSO with gentle warming |
| form | solid |
| pka | 10.29±0.50(Predicted) |
| color | White to off-white |
| InChI | 1S/C15H17FN6O2S/c1-15(2,3)21-25(23,24)11-4-9(6-18-7-11)10-5-12(16)13-19-14(17)20-22(13)8-10/h4-8,21H,1-3H3,(H2,17,20) |
| InChIKey | RXRZPHQBTHQXSV-UHFFFAOYSA-N |
| SMILES | FC1=CC(C2=CN=CC(S(NC(C)(C)C)(=O)=O)=C2)=CN3C1=NC(N)=N3 |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |