
114435-02-8
| Name | 4-Fluoro-1,3-dioxolan-2-one |
| CAS | 114435-02-8 |
| EINECS(EC#) | 483-360-5 |
| Molecular Formula | C3H3FO3 |
| MDL Number | MFCD06247543 |
| Molecular Weight | 106.05 |
| MOL File | 114435-02-8.mol |
Chemical Properties
| Melting point | 18-23 °C |
| Boiling point | 212℃ |
| density | 1.454 |
| vapor pressure | 51Pa at 25℃ |
| refractive index | 1.3960 to 1.4000 |
| Fp | >102°(216°F) |
| storage temp. | 2-8°C |
| form | Liquid |
| color | Colorless |
| Water Solubility | Slightly miscible with water. |
| Major Application | battery manufacturing |
| InChI | InChI=1S/C3H3FO3/c4-2-1-6-3(5)7-2/h2H,1H2 |
| InChIKey | SBLRHMKNNHXPHG-UHFFFAOYSA-N |
| SMILES | O1CC(F)OC1=O |
| LogP | -0.435 at 20.1℃ |
| CAS DataBase Reference | 114435-02-8(CAS DataBase Reference) |
| EPA Substance Registry System | 1,3-Dioxolan-2-one, 4-fluoro- (114435-02-8) |
Safety Data
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 1 |
| TSCA | Yes |
| HS Code | 29329990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 |