
1135070-98-2
| Name | Ethyl-β-D-glucuronide-D5 |
| CAS | 1135070-98-2 |
| EINECS(EC#) | 200-659-6 |
| Molecular Formula | C8H14O7 |
| MDL Number | MFCD09037575 |
| Molecular Weight | 222.19 |
| MOL File | 1135070-98-2.mol |
Chemical Properties
| Melting point | 145-147°C (dec.) |
| Fp | 9℃ |
| storage temp. | -20°C |
| solubility | Methanol (Slightly), Water (Slightly) |
| form | Solid |
| color | White to Off-White |
| Major Application | forensics and toxicology |
| InChI | 1S/C8H14O7/c1-2-14-8-5(11)3(9)4(10)6(15-8)7(12)13/h3-6,8-11H,2H2,1H3,(H,12,13)/t3-,4-,5+,6-,8+/m0/s1/i1D3,2D2 |
| InChIKey | IWJBVMJWSPZNJH-XTJTXKPGSA-N |
| SMILES | O[C@@H]1[C@@H](O)[C@H](OC([2H])([2H])C([2H])([2H])[2H])O[C@H](C(O)=O)[C@H]1O |
Safety Data
| Symbol(GHS) | ![]() ![]() ![]() GHS02,GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H225-H301+H311+H331-H370 |
| Precautionary statements | P210-P280-P301+P310+P330-P302+P352+P312-P304+P340+P311 |
| Hazard Codes | F,T |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN1230 - class 3 - PG 2 - Methanol, solution |
| WGK Germany | 1 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Flam. Liq. 2 STOT SE 1 |


