112281-77-3
| Name | TETRACONAZOLE |
| CAS | 112281-77-3 |
| EINECS(EC#) | 407-760-6 |
| Molecular Formula | C13H11Cl2F4N3O |
| MDL Number | MFCD01632314 |
| Molecular Weight | 372.15 |
| MOL File | 112281-77-3.mol |
Chemical Properties
| Melting point | 6 °C |
| Boiling point | 438.4±55.0 °C(Predicted) |
| density | 1.50±0.1 g/cm3(Predicted) |
| vapor pressure | 1.8 x l0-4 Pa |
| storage temp. | 0-6°C |
| form | neat |
| pka | 2.68±0.10(Predicted) |
| Water Solubility | 156 mg l-1(pH 7,ZO °C) |
| color | Colorless to light yellow |
| Henry's Law Constant | 2.3×103 mol/(m3Pa) at 25℃, HSDB (2015) |
| Major Application | agriculture cleaning products cosmetics environmental food and beverages personal care |
| InChI | 1S/C13H11Cl2F4N3O/c14-9-1-2-10(11(15)3-9)8(4-22-7-20-6-21-22)5-23-13(18,19)12(16)17/h1-3,6-8,12H,4-5H2 |
| InChIKey | LQDARGUHUSPFNL-UHFFFAOYSA-N |
| SMILES | FC(F)C(F)(F)OCC(Cn1cncn1)c2ccc(Cl)cc2Cl |
| LogP | 3.560 |
| EPA Substance Registry System | Tetraconazole (112281-77-3) |
Safety Data
| Hazard Codes | Xn,N |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 3082 9 / PGIII |
| WGK Germany | 3 |
| REACH Registrations | Inactive |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Inhalation Acute Tox. 4 Oral Aquatic Chronic 2 |
| Hazardous Substances Data | 112281-77-3(Hazardous Substances Data) |
| Toxicity |