
112068-01-6
| Name | alpha,alpha-Diphenyl-L-prolinol |
| CAS | 112068-01-6 |
| EINECS(EC#) | 601-153-1 |
| Molecular Formula | C17H19NO |
| MDL Number | MFCD00075506 |
| Molecular Weight | 253.34 |
| MOL File | 112068-01-6.mol |
Chemical Properties
| Appearance | off-white to white crystal powder. |
| Melting point | 77-80 °C(lit.) |
| alpha | -59 º (c=3, methanol 25 ºC) |
| Boiling point | 396.54°C (rough estimate) |
| density | 1.0078 (rough estimate) |
| refractive index | -66.5 ° (C=3, CHCl3) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Soluble in chloroform. |
| form | powder |
| pka | 13.15±0.29(Predicted) |
| color | white to off white ., crystal |
| Optical Rotation | [α]20/D 67°, c = 3 in chloroform |
| Merck | 155 |
| BRN | 17103 |
| InChI | 1S/C17H19NO/c19-17(16-12-7-13-18-16,14-8-3-1-4-9-14)15-10-5-2-6-11-15/h1-6,8-11,16,18-19H,7,12-13H2/t16-/m0/s1 |
| InChIKey | OGCGXUGBDJGFFY-INIZCTEOSA-N |
| SMILES | OC([C@@H]1CCCN1)(c2ccccc2)c3ccccc3 |
| Usage | Pharmaceutical-Intermediate |
| CAS DataBase Reference | 112068-01-6(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| F | 10-34 |
| TSCA | No |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
