
1105698-15-4
| Name | N-[3-[[(2-Hydroxy-1-naphthalenyl)methylene]amino]phenyl]-α-methylbenzeneacetamide |
| CAS | 1105698-15-4 |
| Molecular Formula | C26H22N2O2 |
| MDL Number | MFCD12912446 |
| Molecular Weight | 394.47 |
| MOL File | 1105698-15-4.mol |
Chemical Properties
| Boiling point | 666.7±50.0 °C(Predicted) |
| density | 1.16±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | DMSO: >10mg/mL |
| form | Yellow solid |
| pka | 7.90±0.50(Predicted) |
| color | Yellow |
| Stability: | Stable for 1 year from date of purchase as supplied. Solutions in DMSO, DMF, or ethanol may be stored at -20°C for up to 1 month. |
| InChI | 1S/C26H22N2O2/c1-18(19-8-3-2-4-9-19)26(30)28-22-12-7-11-21(16-22)27-17-24-23-13-6-5-10-20(23)14-15-25(24)29/h2-18,29H,1H3,(H,28,30)/b27-17+ |
| InChIKey | HQSSEGBEYORUBY-WPWMEQJKSA-N |
| SMILES | CC(C(=O)Nc1cccc(c1)\N=C\c2c(O)ccc3ccccc23)c4ccccc4 |
Safety Data
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |