109384-19-2
| Name | N-BOC-4-Hydroxypiperidine |
| CAS | 109384-19-2 |
| EINECS(EC#) | 600-916-6 |
| Molecular Formula | C10H19NO3 |
| MDL Number | MFCD01075174 |
| Molecular Weight | 201.26 |
| MOL File | 109384-19-2.mol |
Chemical Properties
| Appearance | White to cream powder |
| Melting point | 61-65 °C (lit.) |
| Boiling point | 292.3±33.0 °C(Predicted) |
| density | 1.107±0.06 g/cm3(Predicted) |
| storage temp. | Store at-15°C |
| solubility | Chloroform, Ethyl Acetate |
| form | Powder |
| pka | 14.80±0.20(Predicted) |
| color | White to cream |
| Detection Methods | MP,NMR |
| BRN | 7202094 |
| InChI | InChI=1S/C10H19NO3/c1-10(2,3)14-9(13)11-6-4-8(12)5-7-11/h8,12H,4-7H2,1-3H3 |
| InChIKey | PWQLFIKTGRINFF-UHFFFAOYSA-N |
| SMILES | N1(C(OC(C)(C)C)=O)CCC(O)CC1 |
| CAS DataBase Reference | 109384-19-2(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
